C24H37N3O5 — CID 42862348
N-[[4-(2-hydroxy-3-prop-2-enoxypropyl)morpholin-2-yl]methyl]-N-(2-morpholin-4-ylethyl)benzamide (PubChem CID 42862348) has the molecular formula C24H37N3O5 and a molecular weight of 447.58 g/mol. Its IUPAC name is N-[[4-(2-hydroxy-3-prop-2-enoxypropyl)morpholin-2-yl]methyl]-N-(2-morpholin-4-ylethyl)benzamide.
| Compound Name | N-[[4-(2-hydroxy-3-prop-2-enoxypropyl)morpholin-2-yl]methyl]-N-(2-morpholin-4-ylethyl)benzamide |
|---|---|
| PubChem CID | 42862348 |
| Molecular Formula | C24H37N3O5 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.27 |
| IUPAC Name | N-[[4-(2-hydroxy-3-prop-2-enoxypropyl)morpholin-2-yl]methyl]-N-(2-morpholin-4-ylethyl)benzamide |
| SMILES | C=CCOCC(O)CN1CCOC(CN(CCN2CCOCC2)C(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C24H37N3O5/c1-2-13-31-20-22(28)17-26-12-16-32-23(18-26)19-27(9-8-25-10-14-30-15-11-25)24(29)21-6-4-3-5-7-21/h2-7,22-23,28H,1,8-20H2 |
| InChIKey | SRZGKKIXLODGPW-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 74.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|