C26H35N3O4 — CID 42862483
N-[[4-[(2-hydroxyphenyl)methyl]morpholin-2-yl]methyl]-4-methyl-N-(2-morpholin-4-ylethyl)benzamide (PubChem CID 42862483) has the molecular formula C26H35N3O4 and a molecular weight of 453.58 g/mol. Its IUPAC name is N-[[4-[(2-hydroxyphenyl)methyl]morpholin-2-yl]methyl]-4-methyl-N-(2-morpholin-4-ylethyl)benzamide.
| Compound Name | N-[[4-[(2-hydroxyphenyl)methyl]morpholin-2-yl]methyl]-4-methyl-N-(2-morpholin-4-ylethyl)benzamide |
|---|---|
| PubChem CID | 42862483 |
| Molecular Formula | C26H35N3O4 |
| Molecular Weight | 453.58 g/mol |
| Exact Mass | 453.26 |
| IUPAC Name | N-[[4-[(2-hydroxyphenyl)methyl]morpholin-2-yl]methyl]-4-methyl-N-(2-morpholin-4-ylethyl)benzamide |
| SMILES | Cc1ccc(C(=O)N(CCN2CCOCC2)CC2CN(Cc3ccccc3O)CCO2)cc1 |
| InChI | InChI=1S/C26H35N3O4/c1-21-6-8-22(9-7-21)26(31)29(11-10-27-12-15-32-16-13-27)20-24-19-28(14-17-33-24)18-23-4-2-3-5-25(23)30/h2-9,24,30H,10-20H2,1H3 |
| InChIKey | KNQMDILRXLWDJO-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 65.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.58 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|