C29H34N2O — CID 42863585
N-[[1-benzyl-4-(4-methylphenyl)pyrrolidin-3-yl]methyl]-N-propan-2-ylbenzamide (PubChem CID 42863585) has the molecular formula C29H34N2O and a molecular weight of 426.60 g/mol. Its IUPAC name is N-[[1-benzyl-4-(4-methylphenyl)pyrrolidin-3-yl]methyl]-N-propan-2-ylbenzamide.
| Compound Name | N-[[1-benzyl-4-(4-methylphenyl)pyrrolidin-3-yl]methyl]-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 42863585 |
| Molecular Formula | C29H34N2O |
| Molecular Weight | 426.60 g/mol |
| Exact Mass | 426.27 |
| IUPAC Name | N-[[1-benzyl-4-(4-methylphenyl)pyrrolidin-3-yl]methyl]-N-propan-2-ylbenzamide |
| SMILES | Cc1ccc(C2CN(Cc3ccccc3)CC2CN(C(=O)c2ccccc2)C(C)C)cc1 |
| InChI | InChI=1S/C29H34N2O/c1-22(2)31(29(32)26-12-8-5-9-13-26)20-27-19-30(18-24-10-6-4-7-11-24)21-28(27)25-16-14-23(3)15-17-25/h4-17,22,27-28H,18-21H2,1-3H3 |
| InChIKey | GMMQJENTDFGRRD-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.60 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |