C27H34N6 — CID 42864558
N'-benzyl-N'-(3-cyclohexyl-9-methyl-[1,2,4]triazolo[4,3-c]quinazolin-5-yl)-N,N-dimethylethane-1,2-diamine (PubChem CID 42864558) has the molecular formula C27H34N6 and a molecular weight of 442.61 g/mol. Its IUPAC name is N'-benzyl-N'-(3-cyclohexyl-9-methyl-[1,2,4]triazolo[4,3-c]quinazolin-5-yl)-N,N-dimethylethane-1,2-diamine.
| Compound Name | N'-benzyl-N'-(3-cyclohexyl-9-methyl-[1,2,4]triazolo[4,3-c]quinazolin-5-yl)-N,N-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 42864558 |
| Molecular Formula | C27H34N6 |
| Molecular Weight | 442.61 g/mol |
| Exact Mass | 442.28 |
| IUPAC Name | N'-benzyl-N'-(3-cyclohexyl-9-methyl-[1,2,4]triazolo[4,3-c]quinazolin-5-yl)-N,N-dimethylethane-1,2-diamine |
| SMILES | Cc1ccc2nc(N(CCN(C)C)Cc3ccccc3)n3c(C4CCCCC4)nnc3c2c1 |
| InChI | InChI=1S/C27H34N6/c1-20-14-15-24-23(18-20)26-30-29-25(22-12-8-5-9-13-22)33(26)27(28-24)32(17-16-31(2)3)19-21-10-6-4-7-11-21/h4,6-7,10-11,14-15,18,22H,5,8-9,12-13,16-17,19H2,1-3H3 |
| InChIKey | OYPCHXXUGHGUDY-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 49.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.61 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |