C26H34F2N2O4 — CID 42865168
2-(3,4-difluorophenoxy)-N-(3-methoxypropyl)-3-[(3-methylphenyl)methyl-(oxolan-2-ylmethyl)amino]propanamide (PubChem CID 42865168) has the molecular formula C26H34F2N2O4 and a molecular weight of 476.56 g/mol. Its IUPAC name is 2-(3,4-difluorophenoxy)-N-(3-methoxypropyl)-3-[(3-methylphenyl)methyl-(oxolan-2-ylmethyl)amino]propanamide.
| Compound Name | 2-(3,4-difluorophenoxy)-N-(3-methoxypropyl)-3-[(3-methylphenyl)methyl-(oxolan-2-ylmethyl)amino]propanamide |
|---|---|
| PubChem CID | 42865168 |
| Molecular Formula | C26H34F2N2O4 |
| Molecular Weight | 476.56 g/mol |
| Exact Mass | 476.25 |
| IUPAC Name | 2-(3,4-difluorophenoxy)-N-(3-methoxypropyl)-3-[(3-methylphenyl)methyl-(oxolan-2-ylmethyl)amino]propanamide |
| SMILES | COCCCNC(=O)C(CN(Cc1cccc(C)c1)CC1CCCO1)Oc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C26H34F2N2O4/c1-19-6-3-7-20(14-19)16-30(17-22-8-4-13-33-22)18-25(26(31)29-11-5-12-32-2)34-21-9-10-23(27)24(28)15-21/h3,6-7,9-10,14-15,22,25H,4-5,8,11-13,16-18H2,1-2H3,(H,29,31) |
| InChIKey | ZSXKVSGRFKDNOP-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.56 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|