C22H24F2N2O — CID 42865682
1-[(2,4-difluorophenyl)methyl]-5-phenyl-N-prop-2-enylpiperidine-3-carboxamide (PubChem CID 42865682) has the molecular formula C22H24F2N2O and a molecular weight of 370.44 g/mol. Its IUPAC name is 1-[(2,4-difluorophenyl)methyl]-5-phenyl-N-prop-2-enylpiperidine-3-carboxamide.
| Compound Name | 1-[(2,4-difluorophenyl)methyl]-5-phenyl-N-prop-2-enylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 42865682 |
| Molecular Formula | C22H24F2N2O |
| Molecular Weight | 370.44 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | 1-[(2,4-difluorophenyl)methyl]-5-phenyl-N-prop-2-enylpiperidine-3-carboxamide |
| SMILES | C=CCNC(=O)C1CC(c2ccccc2)CN(Cc2ccc(F)cc2F)C1 |
| InChI | InChI=1S/C22H24F2N2O/c1-2-10-25-22(27)19-11-18(16-6-4-3-5-7-16)14-26(15-19)13-17-8-9-20(23)12-21(17)24/h2-9,12,18-19H,1,10-11,13-15H2,(H,25,27) |
| InChIKey | AVMQGTFLNIYBAR-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.44 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|