C21H18N2O4S — CID 42865772
N-(1,3-benzodioxol-5-ylmethyl)-2-(4-prop-2-enoxyphenyl)-1,3-thiazole-4-carboxamide (PubChem CID 42865772) has the molecular formula C21H18N2O4S and a molecular weight of 394.45 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-2-(4-prop-2-enoxyphenyl)-1,3-thiazole-4-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-2-(4-prop-2-enoxyphenyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 42865772 |
| Molecular Formula | C21H18N2O4S |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-2-(4-prop-2-enoxyphenyl)-1,3-thiazole-4-carboxamide |
| SMILES | C=CCOc1ccc(-c2nc(C(=O)NCc3ccc4c(c3)OCO4)cs2)cc1 |
| InChI | InChI=1S/C21H18N2O4S/c1-2-9-25-16-6-4-15(5-7-16)21-23-17(12-28-21)20(24)22-11-14-3-8-18-19(10-14)27-13-26-18/h2-8,10,12H,1,9,11,13H2,(H,22,24) |
| InChIKey | UOEMOASWANPOMV-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|