C28H31FN2O — CID 42866536
1-benzyl-5-(4-fluoro-3-methylphenyl)-N-(1-phenylethyl)piperidine-3-carboxamide (PubChem CID 42866536) has the molecular formula C28H31FN2O and a molecular weight of 430.57 g/mol. Its IUPAC name is 1-benzyl-5-(4-fluoro-3-methylphenyl)-N-(1-phenylethyl)piperidine-3-carboxamide.
| Compound Name | 1-benzyl-5-(4-fluoro-3-methylphenyl)-N-(1-phenylethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 42866536 |
| Molecular Formula | C28H31FN2O |
| Molecular Weight | 430.57 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | 1-benzyl-5-(4-fluoro-3-methylphenyl)-N-(1-phenylethyl)piperidine-3-carboxamide |
| SMILES | Cc1cc(C2CC(C(=O)NC(C)c3ccccc3)CN(Cc3ccccc3)C2)ccc1F |
| InChI | InChI=1S/C28H31FN2O/c1-20-15-24(13-14-27(20)29)25-16-26(19-31(18-25)17-22-9-5-3-6-10-22)28(32)30-21(2)23-11-7-4-8-12-23/h3-15,21,25-26H,16-19H2,1-2H3,(H,30,32) |
| InChIKey | CEHAYIFRDWNWAJ-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.57 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |