C24H30N2O4 — CID 42866823
N-(2-methoxyethyl)-2-[[1-(3-methylphenyl)-2-propanoyl-3,4-dihydro-1H-isoquinolin-7-yl]oxy]acetamide (PubChem CID 42866823) has the molecular formula C24H30N2O4 and a molecular weight of 410.51 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2-[[1-(3-methylphenyl)-2-propanoyl-3,4-dihydro-1H-isoquinolin-7-yl]oxy]acetamide.
| Compound Name | N-(2-methoxyethyl)-2-[[1-(3-methylphenyl)-2-propanoyl-3,4-dihydro-1H-isoquinolin-7-yl]oxy]acetamide |
|---|---|
| PubChem CID | 42866823 |
| Molecular Formula | C24H30N2O4 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | N-(2-methoxyethyl)-2-[[1-(3-methylphenyl)-2-propanoyl-3,4-dihydro-1H-isoquinolin-7-yl]oxy]acetamide |
| SMILES | CCC(=O)N1CCc2ccc(OCC(=O)NCCOC)cc2C1c1cccc(C)c1 |
| InChI | InChI=1S/C24H30N2O4/c1-4-23(28)26-12-10-18-8-9-20(30-16-22(27)25-11-13-29-3)15-21(18)24(26)19-7-5-6-17(2)14-19/h5-9,14-15,24H,4,10-13,16H2,1-3H3,(H,25,27) |
| InChIKey | LLRQWKCPVPGRHQ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|