C25H26FN3O3S — CID 42866894
[2-[4-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]-1,3-thiazol-4-yl]-(4-prop-2-enylpiperazin-1-yl)methanone (PubChem CID 42866894) has the molecular formula C25H26FN3O3S and a molecular weight of 467.57 g/mol. Its IUPAC name is [2-[4-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]-1,3-thiazol-4-yl]-(4-prop-2-enylpiperazin-1-yl)methanone.
| Compound Name | [2-[4-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]-1,3-thiazol-4-yl]-(4-prop-2-enylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 42866894 |
| Molecular Formula | C25H26FN3O3S |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.17 |
| IUPAC Name | [2-[4-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]-1,3-thiazol-4-yl]-(4-prop-2-enylpiperazin-1-yl)methanone |
| SMILES | C=CCN1CCN(C(=O)c2csc(-c3ccc(OCc4ccccc4F)c(OC)c3)n2)CC1 |
| InChI | InChI=1S/C25H26FN3O3S/c1-3-10-28-11-13-29(14-12-28)25(30)21-17-33-24(27-21)18-8-9-22(23(15-18)31-2)32-16-19-6-4-5-7-20(19)26/h3-9,15,17H,1,10-14,16H2,2H3 |
| InChIKey | IYAMKHJRZAZEOK-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|