C6H5Cl3N2OS — CID 4286777
2,2,2-trichloro-N-(4-methyl-1,3-thiazol-2-yl)acetamide (PubChem CID 4286777) has the molecular formula C6H5Cl3N2OS and a molecular weight of 259.55 g/mol. Its IUPAC name is 2,2,2-trichloro-N-(4-methyl-1,3-thiazol-2-yl)acetamide.
| Compound Name | 2,2,2-trichloro-N-(4-methyl-1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 4286777 |
| Molecular Formula | C6H5Cl3N2OS |
| Molecular Weight | 259.55 g/mol |
| Exact Mass | 257.92 |
| IUPAC Name | 2,2,2-trichloro-N-(4-methyl-1,3-thiazol-2-yl)acetamide |
| SMILES | Cc1csc(NC(=O)C(Cl)(Cl)Cl)n1 |
| InChI | InChI=1S/C6H5Cl3N2OS/c1-3-2-13-5(10-3)11-4(12)6(7,8)9/h2H,1H3,(H,10,11,12) |
| InChIKey | KZHNNYPZNCXODK-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.55 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|