C24H25N3O3S — CID 42869133
N-[4-(3-benzyl-2-oxo-1,3-diazinan-1-yl)phenyl]-4-methylbenzenesulfonamide (PubChem CID 42869133) has the molecular formula C24H25N3O3S and a molecular weight of 435.55 g/mol. Its IUPAC name is N-[4-(3-benzyl-2-oxo-1,3-diazinan-1-yl)phenyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[4-(3-benzyl-2-oxo-1,3-diazinan-1-yl)phenyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 42869133 |
| Molecular Formula | C24H25N3O3S |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | N-[4-(3-benzyl-2-oxo-1,3-diazinan-1-yl)phenyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(N3CCCN(Cc4ccccc4)C3=O)cc2)cc1 |
| InChI | InChI=1S/C24H25N3O3S/c1-19-8-14-23(15-9-19)31(29,30)25-21-10-12-22(13-11-21)27-17-5-16-26(24(27)28)18-20-6-3-2-4-7-20/h2-4,6-15,25H,5,16-18H2,1H3 |
| InChIKey | RHVFZJDQHJEQGV-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |