C18H30N4O4S — CID 42869390
3-[4-(dimethylamino)phenyl]-2-methyl-N-(2-morpholin-4-ylethyl)-1,2-oxazolidine-4-sulfonamide (PubChem CID 42869390) has the molecular formula C18H30N4O4S and a molecular weight of 398.53 g/mol. Its IUPAC name is 3-[4-(dimethylamino)phenyl]-2-methyl-N-(2-morpholin-4-ylethyl)-1,2-oxazolidine-4-sulfonamide.
| Compound Name | 3-[4-(dimethylamino)phenyl]-2-methyl-N-(2-morpholin-4-ylethyl)-1,2-oxazolidine-4-sulfonamide |
|---|---|
| PubChem CID | 42869390 |
| Molecular Formula | C18H30N4O4S |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | 3-[4-(dimethylamino)phenyl]-2-methyl-N-(2-morpholin-4-ylethyl)-1,2-oxazolidine-4-sulfonamide |
| SMILES | CN(C)c1ccc(C2C(S(=O)(=O)NCCN3CCOCC3)CON2C)cc1 |
| InChI | InChI=1S/C18H30N4O4S/c1-20(2)16-6-4-15(5-7-16)18-17(14-26-21(18)3)27(23,24)19-8-9-22-10-12-25-13-11-22/h4-7,17-19H,8-14H2,1-3H3 |
| InChIKey | RDABAJSINFCMRK-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|