C19H17FN4O — CID 42874338
1-[5-cyclopropyl-3-(3-fluorophenyl)-1H-pyrazol-4-yl]-3-phenylurea (PubChem CID 42874338) has the molecular formula C19H17FN4O and a molecular weight of 336.37 g/mol. Its IUPAC name is 1-[5-cyclopropyl-3-(3-fluorophenyl)-1H-pyrazol-4-yl]-3-phenylurea.
| Compound Name | 1-[5-cyclopropyl-3-(3-fluorophenyl)-1H-pyrazol-4-yl]-3-phenylurea |
|---|---|
| PubChem CID | 42874338 |
| Molecular Formula | C19H17FN4O |
| Molecular Weight | 336.37 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | 1-[5-cyclopropyl-3-(3-fluorophenyl)-1H-pyrazol-4-yl]-3-phenylurea |
| SMILES | O=C(Nc1ccccc1)Nc1c(-c2cccc(F)c2)n[nH]c1C1CC1 |
| InChI | InChI=1S/C19H17FN4O/c20-14-6-4-5-13(11-14)17-18(16(23-24-17)12-9-10-12)22-19(25)21-15-7-2-1-3-8-15/h1-8,11-12H,9-10H2,(H,23,24)(H2,21,22,25) |
| InChIKey | QOOYNVDZOZRFRC-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.37 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |