C25H23N2+ — CID 4287464
3-(2,4-dimethylphenyl)-2-phenyl-4,5-dihydroimidazo[1,2-a]quinolin-10-ium (PubChem CID 4287464) has the molecular formula C25H23N2+ and a molecular weight of 351.47 g/mol. Its IUPAC name is 3-(2,4-dimethylphenyl)-2-phenyl-4,5-dihydroimidazo[1,2-a]quinolin-10-ium.
| Compound Name | 3-(2,4-dimethylphenyl)-2-phenyl-4,5-dihydroimidazo[1,2-a]quinolin-10-ium |
|---|---|
| PubChem CID | 4287464 |
| Molecular Formula | C25H23N2+ |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | 3-(2,4-dimethylphenyl)-2-phenyl-4,5-dihydroimidazo[1,2-a]quinolin-10-ium |
| SMILES | Cc1ccc(-n2c(-c3ccccc3)c[n+]3c2CCc2ccccc2-3)c(C)c1 |
| InChI | InChI=1S/C25H23N2/c1-18-12-14-22(19(2)16-18)27-24(20-8-4-3-5-9-20)17-26-23-11-7-6-10-21(23)13-15-25(26)27/h3-12,14,16-17H,13,15H2,1-2H3/q+1 |
| InChIKey | FMGRGIOUUGFHJP-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|