C14H12F2N4O2S — CID 42874782
3-[(2,4-difluorophenoxy)methyl]-5-prop-2-enyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-6-one (PubChem CID 42874782) has the molecular formula C14H12F2N4O2S and a molecular weight of 338.34 g/mol. Its IUPAC name is 3-[(2,4-difluorophenoxy)methyl]-5-prop-2-enyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-6-one.
| Compound Name | 3-[(2,4-difluorophenoxy)methyl]-5-prop-2-enyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-6-one |
|---|---|
| PubChem CID | 42874782 |
| Molecular Formula | C14H12F2N4O2S |
| Molecular Weight | 338.34 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | 3-[(2,4-difluorophenoxy)methyl]-5-prop-2-enyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-6-one |
| SMILES | C=CCN1C(=O)CSc2nnc(COc3ccc(F)cc3F)n21 |
| InChI | InChI=1S/C14H12F2N4O2S/c1-2-5-19-13(21)8-23-14-18-17-12(20(14)19)7-22-11-4-3-9(15)6-10(11)16/h2-4,6H,1,5,7-8H2 |
| InChIKey | PGHAVYJEQKRWLR-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.34 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|