C20H18Cl2N4O4S — CID 42875700
[3-[(2,4-dichlorophenoxy)methyl]-6,7-dihydro-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-5-yl]-(3,5-dimethoxyphenyl)methanone (PubChem CID 42875700) has the molecular formula C20H18Cl2N4O4S and a molecular weight of 481.36 g/mol. Its IUPAC name is [3-[(2,4-dichlorophenoxy)methyl]-6,7-dihydro-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-5-yl]-(3,5-dimethoxyphenyl)methanone.
| Compound Name | [3-[(2,4-dichlorophenoxy)methyl]-6,7-dihydro-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-5-yl]-(3,5-dimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 42875700 |
| Molecular Formula | C20H18Cl2N4O4S |
| Molecular Weight | 481.36 g/mol |
| Exact Mass | 480.04 |
| IUPAC Name | [3-[(2,4-dichlorophenoxy)methyl]-6,7-dihydro-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-5-yl]-(3,5-dimethoxyphenyl)methanone |
| SMILES | COc1cc(OC)cc(C(=O)N2CCSc3nnc(COc4ccc(Cl)cc4Cl)n32)c1 |
| InChI | InChI=1S/C20H18Cl2N4O4S/c1-28-14-7-12(8-15(10-14)29-2)19(27)25-5-6-31-20-24-23-18(26(20)25)11-30-17-4-3-13(21)9-16(17)22/h3-4,7-10H,5-6,11H2,1-2H3 |
| InChIKey | KOJDMTMPNPWUAH-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 78.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.36 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |