C33H41N3O2S — CID 42876178
1-[3-methyl-4-(4-pentylbenzoyl)piperazin-1-yl]-3-(4-phenyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)propan-1-one (PubChem CID 42876178) has the molecular formula C33H41N3O2S and a molecular weight of 543.78 g/mol. Its IUPAC name is 1-[3-methyl-4-(4-pentylbenzoyl)piperazin-1-yl]-3-(4-phenyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)propan-1-one.
| Compound Name | 1-[3-methyl-4-(4-pentylbenzoyl)piperazin-1-yl]-3-(4-phenyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)propan-1-one |
|---|---|
| PubChem CID | 42876178 |
| Molecular Formula | C33H41N3O2S |
| Molecular Weight | 543.78 g/mol |
| Exact Mass | 543.29 |
| IUPAC Name | 1-[3-methyl-4-(4-pentylbenzoyl)piperazin-1-yl]-3-(4-phenyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)propan-1-one |
| SMILES | CCCCCc1ccc(C(=O)N2CCN(C(=O)CCN3CCc4sccc4C3c3ccccc3)CC2C)cc1 |
| InChI | InChI=1S/C33H41N3O2S/c1-3-4-6-9-26-12-14-28(15-13-26)33(38)36-22-21-35(24-25(36)2)31(37)17-20-34-19-16-30-29(18-23-39-30)32(34)27-10-7-5-8-11-27/h5,7-8,10-15,18,23,25,32H,3-4,6,9,16-17,19-22,24H2,1-2H3 |
| InChIKey | RKPKIXUGCXVESI-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.78 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|