About 2-[(2,5-dimethylphenyl)sulfonylamino]-N-(pyridin-2-ylmethyl)propanamide
2-[(2,5-dimethylphenyl)sulfonylamino]-N-(pyridin-2-ylmethyl)propanamide (PubChem CID 4287634) has the molecular formula C17H21N3O3S
and a molecular weight of 347.44 g/mol. Its IUPAC name is 2-[(2,5-dimethylphenyl)sulfonylamino]-N-(pyridin-2-ylmethyl)propanamide.
Molecular Properties
| Compound Name | 2-[(2,5-dimethylphenyl)sulfonylamino]-N-(pyridin-2-ylmethyl)propanamide |
| PubChem CID | 4287634 |
| Molecular Formula | C17H21N3O3S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | 2-[(2,5-dimethylphenyl)sulfonylamino]-N-(pyridin-2-ylmethyl)propanamide |
| SMILES | Cc1ccc(C)c(S(=O)(=O)NC(C)C(=O)NCc2ccccn2)c1 |
| InChI | InChI=1S/C17H21N3O3S/c1-12-7-8-13(2)16(10-12)24(22,23)20-14(3)17(21)19-11-15-6-4-5-9-18-15/h4-10,14,20H,11H2,1-3H3,(H,19,21) |
| InChIKey | HMONNBOYMSDSBD-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(2,5-dimethylphenyl)sulfonylamino]-N-(pyridin-2-ylmethyl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2,5-dimethylphenyl)sulfonylamino]-N-(pyridin-2-ylmethyl)propanamide?
The IUPAC name of 2-[(2,5-dimethylphenyl)sulfonylamino]-N-(pyridin-2-ylmethyl)propanamide (CID 4287634) is 2-[(2,5-dimethylphenyl)sulfonylamino]-N-(pyridin-2-ylmethyl)propanamide.
What is the SMILES notation for 2-[(2,5-dimethylphenyl)sulfonylamino]-N-(pyridin-2-ylmethyl)propanamide?
The canonical SMILES for 2-[(2,5-dimethylphenyl)sulfonylamino]-N-(pyridin-2-ylmethyl)propanamide is Cc1ccc(C)c(S(=O)(=O)NC(C)C(=O)NCc2ccccn2)c1.
What is the InChIKey of 2-[(2,5-dimethylphenyl)sulfonylamino]-N-(pyridin-2-ylmethyl)propanamide?
The InChIKey is HMONNBOYMSDSBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21N3O3S/c1-12-7-8-13(2)16(10-12)24(22,23)20-14(3)17(21)19-11-15-6-4-5-9-18-15/h4-10,14,20H,11H2,1-3H3,(H,19,21).
What are the key properties of 2-[(2,5-dimethylphenyl)sulfonylamino]-N-(pyridin-2-ylmethyl)propanamide?
2-[(2,5-dimethylphenyl)sulfonylamino]-N-(pyridin-2-ylmethyl)propanamide has a molecular weight of 347.44 g/mol, XLogP of 1.68, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,5-dimethylphenyl)sulfonylamino]-N-(pyridin-2-ylmethyl)propanamide is sourced from PubChem (CID 4287634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).