C18H15ClN4O3S — CID 42876436
phenyl 3-[(3-chlorophenoxy)methyl]-6,7-dihydro-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine-5-carboxylate (PubChem CID 42876436) has the molecular formula C18H15ClN4O3S and a molecular weight of 402.86 g/mol. Its IUPAC name is phenyl 3-[(3-chlorophenoxy)methyl]-6,7-dihydro-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine-5-carboxylate.
| Compound Name | phenyl 3-[(3-chlorophenoxy)methyl]-6,7-dihydro-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine-5-carboxylate |
|---|---|
| PubChem CID | 42876436 |
| Molecular Formula | C18H15ClN4O3S |
| Molecular Weight | 402.86 g/mol |
| Exact Mass | 402.06 |
| IUPAC Name | phenyl 3-[(3-chlorophenoxy)methyl]-6,7-dihydro-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine-5-carboxylate |
| SMILES | O=C(Oc1ccccc1)N1CCSc2nnc(COc3cccc(Cl)c3)n21 |
| InChI | InChI=1S/C18H15ClN4O3S/c19-13-5-4-8-15(11-13)25-12-16-20-21-17-23(16)22(9-10-27-17)18(24)26-14-6-2-1-3-7-14/h1-8,11H,9-10,12H2 |
| InChIKey | HQPLWZVOXKHYKA-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 69.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.86 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |