C22H18ClFN4O2 — CID 42877638
2-(4-chlorophenyl)-5-(2-fluorophenyl)-N-(2-methoxyethyl)pyrazolo[1,5-a]pyrimidine-7-carboxamide (PubChem CID 42877638) has the molecular formula C22H18ClFN4O2 and a molecular weight of 424.86 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-5-(2-fluorophenyl)-N-(2-methoxyethyl)pyrazolo[1,5-a]pyrimidine-7-carboxamide.
| Compound Name | 2-(4-chlorophenyl)-5-(2-fluorophenyl)-N-(2-methoxyethyl)pyrazolo[1,5-a]pyrimidine-7-carboxamide |
|---|---|
| PubChem CID | 42877638 |
| Molecular Formula | C22H18ClFN4O2 |
| Molecular Weight | 424.86 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | 2-(4-chlorophenyl)-5-(2-fluorophenyl)-N-(2-methoxyethyl)pyrazolo[1,5-a]pyrimidine-7-carboxamide |
| SMILES | COCCNC(=O)c1cc(-c2ccccc2F)nc2cc(-c3ccc(Cl)cc3)nn12 |
| InChI | InChI=1S/C22H18ClFN4O2/c1-30-11-10-25-22(29)20-12-19(16-4-2-3-5-17(16)24)26-21-13-18(27-28(20)21)14-6-8-15(23)9-7-14/h2-9,12-13H,10-11H2,1H3,(H,25,29) |
| InChIKey | VAFGBYOPYKNGJN-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.86 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|