C8H5ClF6N2OS — CID 4287941
4-chloro-2,2,3,3,4,4-hexafluoro-N-(5-methyl-1,3-thiazol-2-yl)butanamide (PubChem CID 4287941) has the molecular formula C8H5ClF6N2OS and a molecular weight of 326.65 g/mol. Its IUPAC name is 4-chloro-2,2,3,3,4,4-hexafluoro-N-(5-methyl-1,3-thiazol-2-yl)butanamide.
| Compound Name | 4-chloro-2,2,3,3,4,4-hexafluoro-N-(5-methyl-1,3-thiazol-2-yl)butanamide |
|---|---|
| PubChem CID | 4287941 |
| Molecular Formula | C8H5ClF6N2OS |
| Molecular Weight | 326.65 g/mol |
| Exact Mass | 325.97 |
| IUPAC Name | 4-chloro-2,2,3,3,4,4-hexafluoro-N-(5-methyl-1,3-thiazol-2-yl)butanamide |
| SMILES | Cc1cnc(NC(=O)C(F)(F)C(F)(F)C(F)(F)Cl)s1 |
| InChI | InChI=1S/C8H5ClF6N2OS/c1-3-2-16-5(19-3)17-4(18)6(10,11)7(12,13)8(9,14)15/h2H,1H3,(H,16,17,18) |
| InChIKey | KQBMHNXXLRIMRP-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.65 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|