C26H20ClF3N2O2 — CID 42880476
2-chloro-2-phenyl-1-[2-[5-[2-(trifluoromethyl)phenyl]-1,3-benzoxazol-2-yl]pyrrolidin-1-yl]ethanone (PubChem CID 42880476) has the molecular formula C26H20ClF3N2O2 and a molecular weight of 484.91 g/mol. Its IUPAC name is 2-chloro-2-phenyl-1-[2-[5-[2-(trifluoromethyl)phenyl]-1,3-benzoxazol-2-yl]pyrrolidin-1-yl]ethanone.
| Compound Name | 2-chloro-2-phenyl-1-[2-[5-[2-(trifluoromethyl)phenyl]-1,3-benzoxazol-2-yl]pyrrolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 42880476 |
| Molecular Formula | C26H20ClF3N2O2 |
| Molecular Weight | 484.91 g/mol |
| Exact Mass | 484.12 |
| IUPAC Name | 2-chloro-2-phenyl-1-[2-[5-[2-(trifluoromethyl)phenyl]-1,3-benzoxazol-2-yl]pyrrolidin-1-yl]ethanone |
| SMILES | O=C(C(Cl)c1ccccc1)N1CCCC1c1nc2cc(-c3ccccc3C(F)(F)F)ccc2o1 |
| InChI | InChI=1S/C26H20ClF3N2O2/c27-23(16-7-2-1-3-8-16)25(33)32-14-6-11-21(32)24-31-20-15-17(12-13-22(20)34-24)18-9-4-5-10-19(18)26(28,29)30/h1-5,7-10,12-13,15,21,23H,6,11,14H2 |
| InChIKey | NRHNXXVIJMGNKG-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.91 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|