C25H30FN3O3 — CID 42880782
benzyl 4-[4-[(4-fluorophenyl)carbamoyl]piperidin-1-yl]piperidine-1-carboxylate (PubChem CID 42880782) has the molecular formula C25H30FN3O3 and a molecular weight of 439.53 g/mol. Its IUPAC name is benzyl 4-[4-[(4-fluorophenyl)carbamoyl]piperidin-1-yl]piperidine-1-carboxylate.
| Compound Name | benzyl 4-[4-[(4-fluorophenyl)carbamoyl]piperidin-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 42880782 |
| Molecular Formula | C25H30FN3O3 |
| Molecular Weight | 439.53 g/mol |
| Exact Mass | 439.23 |
| IUPAC Name | benzyl 4-[4-[(4-fluorophenyl)carbamoyl]piperidin-1-yl]piperidine-1-carboxylate |
| SMILES | O=C(Nc1ccc(F)cc1)C1CCN(C2CCN(C(=O)OCc3ccccc3)CC2)CC1 |
| InChI | InChI=1S/C25H30FN3O3/c26-21-6-8-22(9-7-21)27-24(30)20-10-14-28(15-11-20)23-12-16-29(17-13-23)25(31)32-18-19-4-2-1-3-5-19/h1-9,20,23H,10-18H2,(H,27,30) |
| InChIKey | AODPLVNDTHZEDZ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.53 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |