C18H24FN3 — CID 4288141
N-[(2-fluorophenyl)methyl]-N'-pyridin-2-ylhexane-1,6-diamine (PubChem CID 4288141) has the molecular formula C18H24FN3 and a molecular weight of 301.41 g/mol. Its IUPAC name is N-[(2-fluorophenyl)methyl]-N'-pyridin-2-ylhexane-1,6-diamine.
| Compound Name | N-[(2-fluorophenyl)methyl]-N'-pyridin-2-ylhexane-1,6-diamine |
|---|---|
| PubChem CID | 4288141 |
| Molecular Formula | C18H24FN3 |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.20 |
| IUPAC Name | N-[(2-fluorophenyl)methyl]-N'-pyridin-2-ylhexane-1,6-diamine |
| SMILES | Fc1ccccc1CNCCCCCCNc1ccccn1 |
| InChI | InChI=1S/C18H24FN3/c19-17-10-4-3-9-16(17)15-20-12-6-1-2-7-13-21-18-11-5-8-14-22-18/h3-5,8-11,14,20H,1-2,6-7,12-13,15H2,(H,21,22) |
| InChIKey | LJYITWPVTCCWRC-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|