C30H40N4O2 — CID 42881412
(4-ethylpiperazin-1-yl)-[1-[1-(4-phenylbenzoyl)piperidin-4-yl]piperidin-4-yl]methanone (PubChem CID 42881412) has the molecular formula C30H40N4O2 and a molecular weight of 488.68 g/mol. Its IUPAC name is (4-ethylpiperazin-1-yl)-[1-[1-(4-phenylbenzoyl)piperidin-4-yl]piperidin-4-yl]methanone.
| Compound Name | (4-ethylpiperazin-1-yl)-[1-[1-(4-phenylbenzoyl)piperidin-4-yl]piperidin-4-yl]methanone |
|---|---|
| PubChem CID | 42881412 |
| Molecular Formula | C30H40N4O2 |
| Molecular Weight | 488.68 g/mol |
| Exact Mass | 488.32 |
| IUPAC Name | (4-ethylpiperazin-1-yl)-[1-[1-(4-phenylbenzoyl)piperidin-4-yl]piperidin-4-yl]methanone |
| SMILES | CCN1CCN(C(=O)C2CCN(C3CCN(C(=O)c4ccc(-c5ccccc5)cc4)CC3)CC2)CC1 |
| InChI | InChI=1S/C30H40N4O2/c1-2-31-20-22-34(23-21-31)30(36)27-12-16-32(17-13-27)28-14-18-33(19-15-28)29(35)26-10-8-25(9-11-26)24-6-4-3-5-7-24/h3-11,27-28H,2,12-23H2,1H3 |
| InChIKey | VUDUVDLCOVUDHH-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 47.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.68 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |