C22H22FN3O3 — CID 42883379
ethyl 4-[(8-fluoro-5-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole-2-carbonyl)amino]benzoate (PubChem CID 42883379) has the molecular formula C22H22FN3O3 and a molecular weight of 395.43 g/mol. Its IUPAC name is ethyl 4-[(8-fluoro-5-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole-2-carbonyl)amino]benzoate.
| Compound Name | ethyl 4-[(8-fluoro-5-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole-2-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 42883379 |
| Molecular Formula | C22H22FN3O3 |
| Molecular Weight | 395.43 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | ethyl 4-[(8-fluoro-5-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole-2-carbonyl)amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)N2CCc3c(c4cc(F)ccc4n3C)C2)cc1 |
| InChI | InChI=1S/C22H22FN3O3/c1-3-29-21(27)14-4-7-16(8-5-14)24-22(28)26-11-10-20-18(13-26)17-12-15(23)6-9-19(17)25(20)2/h4-9,12H,3,10-11,13H2,1-2H3,(H,24,28) |
| InChIKey | DOJMBSOPCNVUIT-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.43 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|