C19H17FN2O5 — CID 42883513
2-[(7-fluoro-1-methyl-3-oxo-1,2-dihydroinden-4-yl)oxy]-N-methyl-N-(4-nitrophenyl)acetamide (PubChem CID 42883513) has the molecular formula C19H17FN2O5 and a molecular weight of 372.35 g/mol. Its IUPAC name is 2-[(7-fluoro-1-methyl-3-oxo-1,2-dihydroinden-4-yl)oxy]-N-methyl-N-(4-nitrophenyl)acetamide.
| Compound Name | 2-[(7-fluoro-1-methyl-3-oxo-1,2-dihydroinden-4-yl)oxy]-N-methyl-N-(4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 42883513 |
| Molecular Formula | C19H17FN2O5 |
| Molecular Weight | 372.35 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | 2-[(7-fluoro-1-methyl-3-oxo-1,2-dihydroinden-4-yl)oxy]-N-methyl-N-(4-nitrophenyl)acetamide |
| SMILES | CC1CC(=O)c2c(OCC(=O)N(C)c3ccc([N+](=O)[O-])cc3)ccc(F)c21 |
| InChI | InChI=1S/C19H17FN2O5/c1-11-9-15(23)19-16(8-7-14(20)18(11)19)27-10-17(24)21(2)12-3-5-13(6-4-12)22(25)26/h3-8,11H,9-10H2,1-2H3 |
| InChIKey | XUGKIMCJZLVKBL-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.35 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|