C18H19N3OS — CID 42885212
4-(2-phenylethyl)-3-(1-phenylethylsulfanyl)-1H-1,2,4-triazol-5-one (PubChem CID 42885212) has the molecular formula C18H19N3OS and a molecular weight of 325.44 g/mol. Its IUPAC name is 4-(2-phenylethyl)-3-(1-phenylethylsulfanyl)-1H-1,2,4-triazol-5-one.
| Compound Name | 4-(2-phenylethyl)-3-(1-phenylethylsulfanyl)-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 42885212 |
| Molecular Formula | C18H19N3OS |
| Molecular Weight | 325.44 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | 4-(2-phenylethyl)-3-(1-phenylethylsulfanyl)-1H-1,2,4-triazol-5-one |
| SMILES | CC(Sc1n[nH]c(=O)n1CCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H19N3OS/c1-14(16-10-6-3-7-11-16)23-18-20-19-17(22)21(18)13-12-15-8-4-2-5-9-15/h2-11,14H,12-13H2,1H3,(H,19,22) |
| InChIKey | KTLZTGQSUQPBTG-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.44 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |