C20H25N7 — CID 42885236
2-N-(2-ethylphenyl)-6-[(1-methyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)methyl]-1,3,5-triazine-2,4-diamine (PubChem CID 42885236) has the molecular formula C20H25N7 and a molecular weight of 363.47 g/mol. Its IUPAC name is 2-N-(2-ethylphenyl)-6-[(1-methyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)methyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-(2-ethylphenyl)-6-[(1-methyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)methyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 42885236 |
| Molecular Formula | C20H25N7 |
| Molecular Weight | 363.47 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | 2-N-(2-ethylphenyl)-6-[(1-methyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)methyl]-1,3,5-triazine-2,4-diamine |
| SMILES | CCc1ccccc1Nc1nc(N)nc(CN2CCn3cccc3C2C)n1 |
| InChI | InChI=1S/C20H25N7/c1-3-15-7-4-5-8-16(15)22-20-24-18(23-19(21)25-20)13-27-12-11-26-10-6-9-17(26)14(27)2/h4-10,14H,3,11-13H2,1-2H3,(H3,21,22,23,24,25) |
| InChIKey | GGMMDOHWLYISFD-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 84.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.47 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |