C18H23N3OS3 — CID 42885782
2-[[5-(2-methylprop-2-enylsulfanyl)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2-phenylpropyl)propanamide (PubChem CID 42885782) has the molecular formula C18H23N3OS3 and a molecular weight of 393.60 g/mol. Its IUPAC name is 2-[[5-(2-methylprop-2-enylsulfanyl)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2-phenylpropyl)propanamide.
| Compound Name | 2-[[5-(2-methylprop-2-enylsulfanyl)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2-phenylpropyl)propanamide |
|---|---|
| PubChem CID | 42885782 |
| Molecular Formula | C18H23N3OS3 |
| Molecular Weight | 393.60 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | 2-[[5-(2-methylprop-2-enylsulfanyl)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2-phenylpropyl)propanamide |
| SMILES | C=C(C)CSc1nnc(SC(C)C(=O)NCC(C)c2ccccc2)s1 |
| InChI | InChI=1S/C18H23N3OS3/c1-12(2)11-23-17-20-21-18(25-17)24-14(4)16(22)19-10-13(3)15-8-6-5-7-9-15/h5-9,13-14H,1,10-11H2,2-4H3,(H,19,22) |
| InChIKey | FXFAXVNCMAAEHJ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.60 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|