C22H16N6OS2 — CID 42885922
2-[(5,6-diphenyl-1,2,4-triazin-3-yl)sulfanylmethyl]-7-methyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one (PubChem CID 42885922) has the molecular formula C22H16N6OS2 and a molecular weight of 444.55 g/mol. Its IUPAC name is 2-[(5,6-diphenyl-1,2,4-triazin-3-yl)sulfanylmethyl]-7-methyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one.
| Compound Name | 2-[(5,6-diphenyl-1,2,4-triazin-3-yl)sulfanylmethyl]-7-methyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one |
|---|---|
| PubChem CID | 42885922 |
| Molecular Formula | C22H16N6OS2 |
| Molecular Weight | 444.55 g/mol |
| Exact Mass | 444.08 |
| IUPAC Name | 2-[(5,6-diphenyl-1,2,4-triazin-3-yl)sulfanylmethyl]-7-methyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one |
| SMILES | Cc1cc(=O)n2nc(CSc3nnc(-c4ccccc4)c(-c4ccccc4)n3)sc2n1 |
| InChI | InChI=1S/C22H16N6OS2/c1-14-12-18(29)28-22(23-14)31-17(27-28)13-30-21-24-19(15-8-4-2-5-9-15)20(25-26-21)16-10-6-3-7-11-16/h2-12H,13H2,1H3 |
| InChIKey | HQOXPPNBQSRSHG-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 85.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.55 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |