About 3-tert-butyl-5-[1-(3-methylquinoxalin-2-yl)sulfanylethyl]-1,2,4-oxadiazole
3-tert-butyl-5-[1-(3-methylquinoxalin-2-yl)sulfanylethyl]-1,2,4-oxadiazole (PubChem CID 42885951) has the molecular formula C17H20N4OS
and a molecular weight of 328.44 g/mol. Its IUPAC name is 3-tert-butyl-5-[1-(3-methylquinoxalin-2-yl)sulfanylethyl]-1,2,4-oxadiazole.
Molecular Properties
| Compound Name | 3-tert-butyl-5-[1-(3-methylquinoxalin-2-yl)sulfanylethyl]-1,2,4-oxadiazole |
| PubChem CID | 42885951 |
| Molecular Formula | C17H20N4OS |
| Molecular Weight | 328.44 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | 3-tert-butyl-5-[1-(3-methylquinoxalin-2-yl)sulfanylethyl]-1,2,4-oxadiazole |
| SMILES | Cc1nc2ccccc2nc1SC(C)c1nc(C(C)(C)C)no1 |
| InChI | InChI=1S/C17H20N4OS/c1-10-15(19-13-9-7-6-8-12(13)18-10)23-11(2)14-20-16(21-22-14)17(3,4)5/h6-9,11H,1-5H3 |
| InChIKey | QFIXIPNCLWDHFG-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 64.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.44 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-tert-butyl-5-[1-(3-methylquinoxalin-2-yl)sulfanylethyl]-1,2,4-oxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tert-butyl-5-[1-(3-methylquinoxalin-2-yl)sulfanylethyl]-1,2,4-oxadiazole?
The IUPAC name of 3-tert-butyl-5-[1-(3-methylquinoxalin-2-yl)sulfanylethyl]-1,2,4-oxadiazole (CID 42885951) is 3-tert-butyl-5-[1-(3-methylquinoxalin-2-yl)sulfanylethyl]-1,2,4-oxadiazole.
What is the SMILES notation for 3-tert-butyl-5-[1-(3-methylquinoxalin-2-yl)sulfanylethyl]-1,2,4-oxadiazole?
The canonical SMILES for 3-tert-butyl-5-[1-(3-methylquinoxalin-2-yl)sulfanylethyl]-1,2,4-oxadiazole is Cc1nc2ccccc2nc1SC(C)c1nc(C(C)(C)C)no1.
What is the InChIKey of 3-tert-butyl-5-[1-(3-methylquinoxalin-2-yl)sulfanylethyl]-1,2,4-oxadiazole?
The InChIKey is QFIXIPNCLWDHFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20N4OS/c1-10-15(19-13-9-7-6-8-12(13)18-10)23-11(2)14-20-16(21-22-14)17(3,4)5/h6-9,11H,1-5H3.
What are the key properties of 3-tert-butyl-5-[1-(3-methylquinoxalin-2-yl)sulfanylethyl]-1,2,4-oxadiazole?
3-tert-butyl-5-[1-(3-methylquinoxalin-2-yl)sulfanylethyl]-1,2,4-oxadiazole has a molecular weight of 328.44 g/mol, XLogP of 4.47, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tert-butyl-5-[1-(3-methylquinoxalin-2-yl)sulfanylethyl]-1,2,4-oxadiazole is sourced from PubChem (CID 42885951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).