C22H21N5O3 — CID 42886184
2-(4-cyclopropyl-4-methyl-2,5-dioxoimidazolidin-1-yl)-N-(4-imidazo[1,2-a]pyridin-2-ylphenyl)acetamide (PubChem CID 42886184) has the molecular formula C22H21N5O3 and a molecular weight of 403.44 g/mol. Its IUPAC name is 2-(4-cyclopropyl-4-methyl-2,5-dioxoimidazolidin-1-yl)-N-(4-imidazo[1,2-a]pyridin-2-ylphenyl)acetamide.
| Compound Name | 2-(4-cyclopropyl-4-methyl-2,5-dioxoimidazolidin-1-yl)-N-(4-imidazo[1,2-a]pyridin-2-ylphenyl)acetamide |
|---|---|
| PubChem CID | 42886184 |
| Molecular Formula | C22H21N5O3 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | 2-(4-cyclopropyl-4-methyl-2,5-dioxoimidazolidin-1-yl)-N-(4-imidazo[1,2-a]pyridin-2-ylphenyl)acetamide |
| SMILES | CC1(C2CC2)NC(=O)N(CC(=O)Nc2ccc(-c3cn4ccccc4n3)cc2)C1=O |
| InChI | InChI=1S/C22H21N5O3/c1-22(15-7-8-15)20(29)27(21(30)25-22)13-19(28)23-16-9-5-14(6-10-16)17-12-26-11-3-2-4-18(26)24-17/h2-6,9-12,15H,7-8,13H2,1H3,(H,23,28)(H,25,30) |
| InChIKey | GFJBXXCIRVMGGT-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 95.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|