C23H26N6O2 — CID 42886271
3-[(1-butyltetrazol-5-yl)methyl]-5-(3,4-dimethylphenyl)-5-phenylimidazolidine-2,4-dione (PubChem CID 42886271) has the molecular formula C23H26N6O2 and a molecular weight of 418.50 g/mol. Its IUPAC name is 3-[(1-butyltetrazol-5-yl)methyl]-5-(3,4-dimethylphenyl)-5-phenylimidazolidine-2,4-dione.
| Compound Name | 3-[(1-butyltetrazol-5-yl)methyl]-5-(3,4-dimethylphenyl)-5-phenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 42886271 |
| Molecular Formula | C23H26N6O2 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.21 |
| IUPAC Name | 3-[(1-butyltetrazol-5-yl)methyl]-5-(3,4-dimethylphenyl)-5-phenylimidazolidine-2,4-dione |
| SMILES | CCCCn1nnnc1CN1C(=O)NC(c2ccccc2)(c2ccc(C)c(C)c2)C1=O |
| InChI | InChI=1S/C23H26N6O2/c1-4-5-13-29-20(25-26-27-29)15-28-21(30)23(24-22(28)31,18-9-7-6-8-10-18)19-12-11-16(2)17(3)14-19/h6-12,14H,4-5,13,15H2,1-3H3,(H,24,31) |
| InChIKey | ATGRYLBIZSVBFW-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 93.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|