C18H17N5O4S2 — CID 42886482
7-[[5-(2,4-dimethoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanylmethyl]-2-ethyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one (PubChem CID 42886482) has the molecular formula C18H17N5O4S2 and a molecular weight of 431.50 g/mol. Its IUPAC name is 7-[[5-(2,4-dimethoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanylmethyl]-2-ethyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one.
| Compound Name | 7-[[5-(2,4-dimethoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanylmethyl]-2-ethyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one |
|---|---|
| PubChem CID | 42886482 |
| Molecular Formula | C18H17N5O4S2 |
| Molecular Weight | 431.50 g/mol |
| Exact Mass | 431.07 |
| IUPAC Name | 7-[[5-(2,4-dimethoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanylmethyl]-2-ethyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one |
| SMILES | CCc1nn2c(=O)cc(CSc3nnc(-c4ccc(OC)cc4OC)o3)nc2s1 |
| InChI | InChI=1S/C18H17N5O4S2/c1-4-14-22-23-15(24)7-10(19-17(23)29-14)9-28-18-21-20-16(27-18)12-6-5-11(25-2)8-13(12)26-3/h5-8H,4,9H2,1-3H3 |
| InChIKey | GLDYJMQAYLJFQM-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 104.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.50 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |