C25H30N2O4 — CID 42886695
N-(4-acetylphenyl)-1-butyl-2-(4-methoxyphenyl)-6-oxopiperidine-3-carboxamide (PubChem CID 42886695) has the molecular formula C25H30N2O4 and a molecular weight of 422.53 g/mol. Its IUPAC name is N-(4-acetylphenyl)-1-butyl-2-(4-methoxyphenyl)-6-oxopiperidine-3-carboxamide.
| Compound Name | N-(4-acetylphenyl)-1-butyl-2-(4-methoxyphenyl)-6-oxopiperidine-3-carboxamide |
|---|---|
| PubChem CID | 42886695 |
| Molecular Formula | C25H30N2O4 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | N-(4-acetylphenyl)-1-butyl-2-(4-methoxyphenyl)-6-oxopiperidine-3-carboxamide |
| SMILES | CCCCN1C(=O)CCC(C(=O)Nc2ccc(C(C)=O)cc2)C1c1ccc(OC)cc1 |
| InChI | InChI=1S/C25H30N2O4/c1-4-5-16-27-23(29)15-14-22(24(27)19-8-12-21(31-3)13-9-19)25(30)26-20-10-6-18(7-11-20)17(2)28/h6-13,22,24H,4-5,14-16H2,1-3H3,(H,26,30) |
| InChIKey | BFXBNYSUNSMMGG-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |