C16H26N8S — CID 42889441
6-[1-[[5-(2-cyclopentylethyl)-1H-1,2,4-triazol-3-yl]sulfanyl]ethyl]-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine (PubChem CID 42889441) has the molecular formula C16H26N8S and a molecular weight of 362.51 g/mol. Its IUPAC name is 6-[1-[[5-(2-cyclopentylethyl)-1H-1,2,4-triazol-3-yl]sulfanyl]ethyl]-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[1-[[5-(2-cyclopentylethyl)-1H-1,2,4-triazol-3-yl]sulfanyl]ethyl]-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 42889441 |
| Molecular Formula | C16H26N8S |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | 6-[1-[[5-(2-cyclopentylethyl)-1H-1,2,4-triazol-3-yl]sulfanyl]ethyl]-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine |
| SMILES | CC(Sc1n[nH]c(CCC2CCCC2)n1)c1nc(N)nc(N(C)C)n1 |
| InChI | InChI=1S/C16H26N8S/c1-10(13-19-14(17)21-15(20-13)24(2)3)25-16-18-12(22-23-16)9-8-11-6-4-5-7-11/h10-11H,4-9H2,1-3H3,(H,18,22,23)(H2,17,19,20,21) |
| InChIKey | MWXBCTAYAMTJHT-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 109.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |