C15H18N8S — CID 42889765
2-N,2-N-dimethyl-6-[1-[(1-phenyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]-1,3,5-triazine-2,4-diamine (PubChem CID 42889765) has the molecular formula C15H18N8S and a molecular weight of 342.43 g/mol. Its IUPAC name is 2-N,2-N-dimethyl-6-[1-[(1-phenyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N,2-N-dimethyl-6-[1-[(1-phenyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 42889765 |
| Molecular Formula | C15H18N8S |
| Molecular Weight | 342.43 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | 2-N,2-N-dimethyl-6-[1-[(1-phenyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]-1,3,5-triazine-2,4-diamine |
| SMILES | CC(Sc1ncn(-c2ccccc2)n1)c1nc(N)nc(N(C)C)n1 |
| InChI | InChI=1S/C15H18N8S/c1-10(12-18-13(16)20-14(19-12)22(2)3)24-15-17-9-23(21-15)11-7-5-4-6-8-11/h4-10H,1-3H3,(H2,16,18,19,20) |
| InChIKey | VRCLDNWTGBCKBT-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 98.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.43 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |