C24H19FN6O2 — CID 42889971
[6-(2-fluorophenyl)-3-methyl-[1,2]oxazolo[5,4-b]pyridin-4-yl]-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)pyrrolidin-1-yl]methanone (PubChem CID 42889971) has the molecular formula C24H19FN6O2 and a molecular weight of 442.45 g/mol. Its IUPAC name is [6-(2-fluorophenyl)-3-methyl-[1,2]oxazolo[5,4-b]pyridin-4-yl]-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)pyrrolidin-1-yl]methanone.
| Compound Name | [6-(2-fluorophenyl)-3-methyl-[1,2]oxazolo[5,4-b]pyridin-4-yl]-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 42889971 |
| Molecular Formula | C24H19FN6O2 |
| Molecular Weight | 442.45 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | [6-(2-fluorophenyl)-3-methyl-[1,2]oxazolo[5,4-b]pyridin-4-yl]-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)pyrrolidin-1-yl]methanone |
| SMILES | Cc1noc2nc(-c3ccccc3F)cc(C(=O)N3CCCC3c3nnc4ccccn34)c12 |
| InChI | InChI=1S/C24H19FN6O2/c1-14-21-16(13-18(26-23(21)33-29-14)15-7-2-3-8-17(15)25)24(32)30-12-6-9-19(30)22-28-27-20-10-4-5-11-31(20)22/h2-5,7-8,10-11,13,19H,6,9,12H2,1H3 |
| InChIKey | BYQMBCVEADRKTD-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 89.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.45 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |