C21H22N6O2S — CID 42890430
N-[cyclopropyl(phenyl)methyl]-4-[[2-(1-methyltetrazol-5-yl)sulfanylacetyl]amino]benzamide (PubChem CID 42890430) has the molecular formula C21H22N6O2S and a molecular weight of 422.51 g/mol. Its IUPAC name is N-[cyclopropyl(phenyl)methyl]-4-[[2-(1-methyltetrazol-5-yl)sulfanylacetyl]amino]benzamide.
| Compound Name | N-[cyclopropyl(phenyl)methyl]-4-[[2-(1-methyltetrazol-5-yl)sulfanylacetyl]amino]benzamide |
|---|---|
| PubChem CID | 42890430 |
| Molecular Formula | C21H22N6O2S |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | N-[cyclopropyl(phenyl)methyl]-4-[[2-(1-methyltetrazol-5-yl)sulfanylacetyl]amino]benzamide |
| SMILES | Cn1nnnc1SCC(=O)Nc1ccc(C(=O)NC(c2ccccc2)C2CC2)cc1 |
| InChI | InChI=1S/C21H22N6O2S/c1-27-21(24-25-26-27)30-13-18(28)22-17-11-9-16(10-12-17)20(29)23-19(15-7-8-15)14-5-3-2-4-6-14/h2-6,9-12,15,19H,7-8,13H2,1H3,(H,22,28)(H,23,29) |
| InChIKey | DBFATHJCPJBHND-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |