C13H18N2O3 — CID 42891354
1-(furan-3-carbonyl)-N,N-dimethylpiperidine-3-carboxamide (PubChem CID 42891354) has the molecular formula C13H18N2O3 and a molecular weight of 250.30 g/mol. Its IUPAC name is 1-(furan-3-carbonyl)-N,N-dimethylpiperidine-3-carboxamide.
| Compound Name | 1-(furan-3-carbonyl)-N,N-dimethylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 42891354 |
| Molecular Formula | C13H18N2O3 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | 1-(furan-3-carbonyl)-N,N-dimethylpiperidine-3-carboxamide |
| SMILES | CN(C)C(=O)C1CCCN(C(=O)c2ccoc2)C1 |
| InChI | InChI=1S/C13H18N2O3/c1-14(2)12(16)10-4-3-6-15(8-10)13(17)11-5-7-18-9-11/h5,7,9-10H,3-4,6,8H2,1-2H3 |
| InChIKey | RCLZSHXWVGIBHA-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 53.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |