C17H20N4O2 — CID 42892028
N-[2-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-3-nitropyridin-2-amine (PubChem CID 42892028) has the molecular formula C17H20N4O2 and a molecular weight of 312.37 g/mol. Its IUPAC name is N-[2-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-3-nitropyridin-2-amine.
| Compound Name | N-[2-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-3-nitropyridin-2-amine |
|---|---|
| PubChem CID | 42892028 |
| Molecular Formula | C17H20N4O2 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | N-[2-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-3-nitropyridin-2-amine |
| SMILES | CC(CNc1ncccc1[N+](=O)[O-])N1CCc2ccccc2C1 |
| InChI | InChI=1S/C17H20N4O2/c1-13(11-19-17-16(21(22)23)7-4-9-18-17)20-10-8-14-5-2-3-6-15(14)12-20/h2-7,9,13H,8,10-12H2,1H3,(H,18,19) |
| InChIKey | IFDMTJDHKSTYAB-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 71.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|