C19H14ClN5OS2 — CID 42892207
2-(4-chlorophenyl)-5-[(3-phenyl-5,6-dihydro-[1,3]thiazolo[2,3-c][1,2,4]triazol-5-yl)methylsulfanyl]-1,3,4-oxadiazole (PubChem CID 42892207) has the molecular formula C19H14ClN5OS2 and a molecular weight of 427.94 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-5-[(3-phenyl-5,6-dihydro-[1,3]thiazolo[2,3-c][1,2,4]triazol-5-yl)methylsulfanyl]-1,3,4-oxadiazole.
| Compound Name | 2-(4-chlorophenyl)-5-[(3-phenyl-5,6-dihydro-[1,3]thiazolo[2,3-c][1,2,4]triazol-5-yl)methylsulfanyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 42892207 |
| Molecular Formula | C19H14ClN5OS2 |
| Molecular Weight | 427.94 g/mol |
| Exact Mass | 427.03 |
| IUPAC Name | 2-(4-chlorophenyl)-5-[(3-phenyl-5,6-dihydro-[1,3]thiazolo[2,3-c][1,2,4]triazol-5-yl)methylsulfanyl]-1,3,4-oxadiazole |
| SMILES | Clc1ccc(-c2nnc(SCC3CSc4nnc(-c5ccccc5)n43)o2)cc1 |
| InChI | InChI=1S/C19H14ClN5OS2/c20-14-8-6-13(7-9-14)17-22-24-19(26-17)28-11-15-10-27-18-23-21-16(25(15)18)12-4-2-1-3-5-12/h1-9,15H,10-11H2 |
| InChIKey | SFRNUGKCCHACSJ-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 69.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.94 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |