About pyridin-2-ylmethyl heptanoate
pyridin-2-ylmethyl heptanoate (PubChem CID 4289263) has the molecular formula C13H19NO2
and a molecular weight of 221.30 g/mol. Its IUPAC name is pyridin-2-ylmethyl heptanoate.
Molecular Properties
| Compound Name | pyridin-2-ylmethyl heptanoate |
| PubChem CID | 4289263 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | pyridin-2-ylmethyl heptanoate |
| SMILES | CCCCCCC(=O)OCc1ccccn1 |
| InChI | InChI=1S/C13H19NO2/c1-2-3-4-5-9-13(15)16-11-12-8-6-7-10-14-12/h6-8,10H,2-5,9,11H2,1H3 |
| InChIKey | CFUIQKBYPJYTJE-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze pyridin-2-ylmethyl heptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridin-2-ylmethyl heptanoate?
The IUPAC name of pyridin-2-ylmethyl heptanoate (CID 4289263) is pyridin-2-ylmethyl heptanoate.
What is the SMILES notation for pyridin-2-ylmethyl heptanoate?
The canonical SMILES for pyridin-2-ylmethyl heptanoate is CCCCCCC(=O)OCc1ccccn1.
What is the InChIKey of pyridin-2-ylmethyl heptanoate?
The InChIKey is CFUIQKBYPJYTJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO2/c1-2-3-4-5-9-13(15)16-11-12-8-6-7-10-14-12/h6-8,10H,2-5,9,11H2,1H3.
What are the key properties of pyridin-2-ylmethyl heptanoate?
pyridin-2-ylmethyl heptanoate has a molecular weight of 221.30 g/mol, XLogP of 3.10, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pyridin-2-ylmethyl heptanoate is sourced from PubChem (CID 4289263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).