C19H27N5OS — CID 42892709
2-[3-(4-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-(1-piperidin-1-ylpropan-2-yl)acetamide (PubChem CID 42892709) has the molecular formula C19H27N5OS and a molecular weight of 373.53 g/mol. Its IUPAC name is 2-[3-(4-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-(1-piperidin-1-ylpropan-2-yl)acetamide.
| Compound Name | 2-[3-(4-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-(1-piperidin-1-ylpropan-2-yl)acetamide |
|---|---|
| PubChem CID | 42892709 |
| Molecular Formula | C19H27N5OS |
| Molecular Weight | 373.53 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | 2-[3-(4-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-(1-piperidin-1-ylpropan-2-yl)acetamide |
| SMILES | Cc1ccc(-c2n[nH]c(=S)n2CC(=O)NC(C)CN2CCCCC2)cc1 |
| InChI | InChI=1S/C19H27N5OS/c1-14-6-8-16(9-7-14)18-21-22-19(26)24(18)13-17(25)20-15(2)12-23-10-4-3-5-11-23/h6-9,15H,3-5,10-13H2,1-2H3,(H,20,25)(H,22,26) |
| InChIKey | ATPOEZAOIKPCLU-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 65.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.53 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|