About 2-phenoxy-N-[2-(1,2,4-triazol-1-yl)-5-(trifluoromethyl)phenyl]propanamide
2-phenoxy-N-[2-(1,2,4-triazol-1-yl)-5-(trifluoromethyl)phenyl]propanamide (PubChem CID 42893203) has the molecular formula C18H15F3N4O2
and a molecular weight of 376.34 g/mol. Its IUPAC name is 2-phenoxy-N-[2-(1,2,4-triazol-1-yl)-5-(trifluoromethyl)phenyl]propanamide.
Molecular Properties
| Compound Name | 2-phenoxy-N-[2-(1,2,4-triazol-1-yl)-5-(trifluoromethyl)phenyl]propanamide |
| PubChem CID | 42893203 |
| Molecular Formula | C18H15F3N4O2 |
| Molecular Weight | 376.34 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | 2-phenoxy-N-[2-(1,2,4-triazol-1-yl)-5-(trifluoromethyl)phenyl]propanamide |
| SMILES | CC(Oc1ccccc1)C(=O)Nc1cc(C(F)(F)F)ccc1-n1cncn1 |
| InChI | InChI=1S/C18H15F3N4O2/c1-12(27-14-5-3-2-4-6-14)17(26)24-15-9-13(18(19,20)21)7-8-16(15)25-11-22-10-23-25/h2-12H,1H3,(H,24,26) |
| InChIKey | FROVSXMDWDNZLY-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.34 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-phenoxy-N-[2-(1,2,4-triazol-1-yl)-5-(trifluoromethyl)phenyl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenoxy-N-[2-(1,2,4-triazol-1-yl)-5-(trifluoromethyl)phenyl]propanamide?
The IUPAC name of 2-phenoxy-N-[2-(1,2,4-triazol-1-yl)-5-(trifluoromethyl)phenyl]propanamide (CID 42893203) is 2-phenoxy-N-[2-(1,2,4-triazol-1-yl)-5-(trifluoromethyl)phenyl]propanamide.
What is the SMILES notation for 2-phenoxy-N-[2-(1,2,4-triazol-1-yl)-5-(trifluoromethyl)phenyl]propanamide?
The canonical SMILES for 2-phenoxy-N-[2-(1,2,4-triazol-1-yl)-5-(trifluoromethyl)phenyl]propanamide is CC(Oc1ccccc1)C(=O)Nc1cc(C(F)(F)F)ccc1-n1cncn1.
What is the InChIKey of 2-phenoxy-N-[2-(1,2,4-triazol-1-yl)-5-(trifluoromethyl)phenyl]propanamide?
The InChIKey is FROVSXMDWDNZLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15F3N4O2/c1-12(27-14-5-3-2-4-6-14)17(26)24-15-9-13(18(19,20)21)7-8-16(15)25-11-22-10-23-25/h2-12H,1H3,(H,24,26).
What are the key properties of 2-phenoxy-N-[2-(1,2,4-triazol-1-yl)-5-(trifluoromethyl)phenyl]propanamide?
2-phenoxy-N-[2-(1,2,4-triazol-1-yl)-5-(trifluoromethyl)phenyl]propanamide has a molecular weight of 376.34 g/mol, XLogP of 3.69, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenoxy-N-[2-(1,2,4-triazol-1-yl)-5-(trifluoromethyl)phenyl]propanamide is sourced from PubChem (CID 42893203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).