C21H24N8O2S — CID 42893606
6-[1-[[4-(furan-2-ylmethyl)-5-(3-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]ethyl]-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine (PubChem CID 42893606) has the molecular formula C21H24N8O2S and a molecular weight of 452.54 g/mol. Its IUPAC name is 6-[1-[[4-(furan-2-ylmethyl)-5-(3-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]ethyl]-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[1-[[4-(furan-2-ylmethyl)-5-(3-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]ethyl]-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 42893606 |
| Molecular Formula | C21H24N8O2S |
| Molecular Weight | 452.54 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | 6-[1-[[4-(furan-2-ylmethyl)-5-(3-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]ethyl]-2-N,2-N-dimethyl-1,3,5-triazine-2,4-diamine |
| SMILES | COc1cccc(-c2nnc(SC(C)c3nc(N)nc(N(C)C)n3)n2Cc2ccco2)c1 |
| InChI | InChI=1S/C21H24N8O2S/c1-13(17-23-19(22)25-20(24-17)28(2)3)32-21-27-26-18(14-7-5-8-15(11-14)30-4)29(21)12-16-9-6-10-31-16/h5-11,13H,12H2,1-4H3,(H2,22,23,24,25) |
| InChIKey | BROXNBVRYHBTER-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 121.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.54 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |