C14H25N3OS — CID 4289432
[[4-oxo-4-(2,6,6-trimethylcyclohex-2-en-1-yl)butan-2-yl]amino]thiourea (PubChem CID 4289432) has the molecular formula C14H25N3OS and a molecular weight of 283.44 g/mol. Its IUPAC name is [[4-oxo-4-(2,6,6-trimethylcyclohex-2-en-1-yl)butan-2-yl]amino]thiourea.
| Compound Name | [[4-oxo-4-(2,6,6-trimethylcyclohex-2-en-1-yl)butan-2-yl]amino]thiourea |
|---|---|
| PubChem CID | 4289432 |
| Molecular Formula | C14H25N3OS |
| Molecular Weight | 283.44 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | [[4-oxo-4-(2,6,6-trimethylcyclohex-2-en-1-yl)butan-2-yl]amino]thiourea |
| SMILES | CC1=CCCC(C)(C)C1C(=O)CC(C)NNC(N)=S |
| InChI | InChI=1S/C14H25N3OS/c1-9-6-5-7-14(3,4)12(9)11(18)8-10(2)16-17-13(15)19/h6,10,12,16H,5,7-8H2,1-4H3,(H3,15,17,19) |
| InChIKey | XDHYBOXQEJOYSZ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.44 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|