C19H25N5O3S — CID 42894798
ethyl 1-[2-(1-benzyltetrazol-5-yl)sulfanylpropanoyl]piperidine-4-carboxylate (PubChem CID 42894798) has the molecular formula C19H25N5O3S and a molecular weight of 403.51 g/mol. Its IUPAC name is ethyl 1-[2-(1-benzyltetrazol-5-yl)sulfanylpropanoyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[2-(1-benzyltetrazol-5-yl)sulfanylpropanoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 42894798 |
| Molecular Formula | C19H25N5O3S |
| Molecular Weight | 403.51 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | ethyl 1-[2-(1-benzyltetrazol-5-yl)sulfanylpropanoyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)C(C)Sc2nnnn2Cc2ccccc2)CC1 |
| InChI | InChI=1S/C19H25N5O3S/c1-3-27-18(26)16-9-11-23(12-10-16)17(25)14(2)28-19-20-21-22-24(19)13-15-7-5-4-6-8-15/h4-8,14,16H,3,9-13H2,1-2H3 |
| InChIKey | JSVZSGSXCMWQBX-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 90.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.51 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |